C34H48BN5O4 — CID 70894747
6-[bis(pyridin-2-ylmethyl)amino]-N-[2-oxo-2-[2-[(2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]ethyl]hexanamide (PubChem CID 70894747) has the molecular formula C34H48BN5O4 and a molecular weight of 601.60 g/mol. Its IUPAC name is 6-[bis(pyridin-2-ylmethyl)amino]-N-[2-oxo-2-[2-[(2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]ethyl]hexanamide.
| Compound Name | 6-[bis(pyridin-2-ylmethyl)amino]-N-[2-oxo-2-[2-[(2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]ethyl]hexanamide |
|---|---|
| PubChem CID | 70894747 |
| Molecular Formula | C34H48BN5O4 |
| Molecular Weight | 601.60 g/mol |
| Exact Mass | 601.38 |
| IUPAC Name | 6-[bis(pyridin-2-ylmethyl)amino]-N-[2-oxo-2-[2-[(2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidin-1-yl]ethyl]hexanamide |
| SMILES | CC1(C)C2C[C@H]1C[C@H]1OB(C3CCCN3C(=O)CNC(=O)CCCCCN(Cc3ccccn3)Cc3ccccn3)O[C@@]21C |
| InChI | InChI=1S/C34H48BN5O4/c1-33(2)25-20-28(33)34(3)29(21-25)43-35(44-34)30-14-11-19-40(30)32(42)22-38-31(41)15-5-4-10-18-39(23-26-12-6-8-16-36-26)24-27-13-7-9-17-37-27/h6-9,12-13,16-17,25,28-30H,4-5,10-11,14-15,18-24H2,1-3H3,(H,38,41)/t25-,28?,29+,30?,34-/m0/s1 |
| InChIKey | TVLKHGSVYQAWCE-ILHJDVARSA-N |
| XLogP | 4.41 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.60 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|