C19H28N2O — CID 97213186
1-[(4aR,6R,8aR)-6-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-4-pyridin-2-ylbutan-1-one (PubChem CID 97213186) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is 1-[(4aR,6R,8aR)-6-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-4-pyridin-2-ylbutan-1-one.
| Compound Name | 1-[(4aR,6R,8aR)-6-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-4-pyridin-2-ylbutan-1-one |
|---|---|
| PubChem CID | 97213186 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | 1-[(4aR,6R,8aR)-6-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-4-pyridin-2-ylbutan-1-one |
| SMILES | C[C@@H]1CC[C@@H]2[C@H](CCCN2C(=O)CCCc2ccccn2)C1 |
| InChI | InChI=1S/C19H28N2O/c1-15-10-11-18-16(14-15)6-5-13-21(18)19(22)9-4-8-17-7-2-3-12-20-17/h2-3,7,12,15-16,18H,4-6,8-11,13-14H2,1H3/t15-,16-,18-/m1/s1 |
| InChIKey | DKTFZDJUOGKNNR-JFIYKMOQSA-N |
| XLogP | 3.83 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |