C17H26N2O3 — CID 100864507
1-[3-[(4aS,6R,8aR)-6-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-3-oxopropyl]pyrrolidine-2,5-dione (PubChem CID 100864507) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is 1-[3-[(4aS,6R,8aR)-6-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-3-oxopropyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[3-[(4aS,6R,8aR)-6-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-3-oxopropyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 100864507 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 1-[3-[(4aS,6R,8aR)-6-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-3-oxopropyl]pyrrolidine-2,5-dione |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](CCCN2C(=O)CCN2C(=O)CCC2=O)C1 |
| InChI | InChI=1S/C17H26N2O3/c1-12-4-5-14-13(11-12)3-2-9-18(14)17(22)8-10-19-15(20)6-7-16(19)21/h12-14H,2-11H2,1H3/t12-,13+,14-/m1/s1 |
| InChIKey | ZCYYRPCWEZBVJE-HZSPNIEDSA-N |
| XLogP | 1.95 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|