C22H40N2O5 — CID 70838999
3-[2-(3-ethyl-2,5-dioxoimidazolidin-1-yl)-3,3-dimethylheptan-4-yl]oxy-2,2-dimethylhexanoic acid (PubChem CID 70838999) has the molecular formula C22H40N2O5 and a molecular weight of 412.57 g/mol. Its IUPAC name is 3-[2-(3-ethyl-2,5-dioxoimidazolidin-1-yl)-3,3-dimethylheptan-4-yl]oxy-2,2-dimethylhexanoic acid.
| Compound Name | 3-[2-(3-ethyl-2,5-dioxoimidazolidin-1-yl)-3,3-dimethylheptan-4-yl]oxy-2,2-dimethylhexanoic acid |
|---|---|
| PubChem CID | 70838999 |
| Molecular Formula | C22H40N2O5 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.29 |
| IUPAC Name | 3-[2-(3-ethyl-2,5-dioxoimidazolidin-1-yl)-3,3-dimethylheptan-4-yl]oxy-2,2-dimethylhexanoic acid |
| SMILES | CCCC(OC(CCC)C(C)(C)C(C)N1C(=O)CN(CC)C1=O)C(C)(C)C(=O)O |
| InChI | InChI=1S/C22H40N2O5/c1-9-12-16(29-17(13-10-2)22(7,8)19(26)27)21(5,6)15(4)24-18(25)14-23(11-3)20(24)28/h15-17H,9-14H2,1-8H3,(H,26,27) |
| InChIKey | WZGZOVWWAHOWSG-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|