C22H32N4O3S — CID 70840877
[4-[[4-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]amino]-2-methyl-6H-1,3,5-oxathiazin-2-yl]methyl]piperidin-1-yl]-(5-methyl-1,2-oxazol-3-yl)methanone (PubChem CID 70840877) has the molecular formula C22H32N4O3S and a molecular weight of 432.59 g/mol. Its IUPAC name is [4-[[4-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]amino]-2-methyl-6H-1,3,5-oxathiazin-2-yl]methyl]piperidin-1-yl]-(5-methyl-1,2-oxazol-3-yl)methanone.
| Compound Name | [4-[[4-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]amino]-2-methyl-6H-1,3,5-oxathiazin-2-yl]methyl]piperidin-1-yl]-(5-methyl-1,2-oxazol-3-yl)methanone |
|---|---|
| PubChem CID | 70840877 |
| Molecular Formula | C22H32N4O3S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | [4-[[4-[[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]amino]-2-methyl-6H-1,3,5-oxathiazin-2-yl]methyl]piperidin-1-yl]-(5-methyl-1,2-oxazol-3-yl)methanone |
| SMILES | Cc1cc(C(=O)N2CCC(CC3(C)OCN=C(N[C@H]4C[C@@H]5CC[C@H]4C5)S3)CC2)no1 |
| InChI | InChI=1S/C22H32N4O3S/c1-14-9-19(25-29-14)20(27)26-7-5-15(6-8-26)12-22(2)28-13-23-21(30-22)24-18-11-16-3-4-17(18)10-16/h9,15-18H,3-8,10-13H2,1-2H3,(H,23,24)/t16-,17+,18+,22?/m1/s1 |
| InChIKey | ZWOWEURAKCKLLY-FHSMGZOOSA-N |
| XLogP | 3.80 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |