C16H19N5 — CID 70841616
3-butyl-N-(pyridin-2-ylmethyl)imidazo[1,2-b]pyridazin-6-amine (PubChem CID 70841616) has the molecular formula C16H19N5 and a molecular weight of 281.36 g/mol. Its IUPAC name is 3-butyl-N-(pyridin-2-ylmethyl)imidazo[1,2-b]pyridazin-6-amine.
| Compound Name | 3-butyl-N-(pyridin-2-ylmethyl)imidazo[1,2-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 70841616 |
| Molecular Formula | C16H19N5 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 3-butyl-N-(pyridin-2-ylmethyl)imidazo[1,2-b]pyridazin-6-amine |
| SMILES | CCCCc1cnc2ccc(NCc3ccccn3)nn12 |
| InChI | InChI=1S/C16H19N5/c1-2-3-7-14-12-19-16-9-8-15(20-21(14)16)18-11-13-6-4-5-10-17-13/h4-6,8-10,12H,2-3,7,11H2,1H3,(H,18,20) |
| InChIKey | GTMHRYGUSWZGTL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |