C58H40N8O3 — CID 70842178
2,5-bis[4-[[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenoxy]methyl]phenyl]-1,3,4-oxadiazole (PubChem CID 70842178) has the molecular formula C58H40N8O3 and a molecular weight of 897.01 g/mol. Its IUPAC name is 2,5-bis[4-[[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenoxy]methyl]phenyl]-1,3,4-oxadiazole.
| Compound Name | 2,5-bis[4-[[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenoxy]methyl]phenyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 70842178 |
| Molecular Formula | C58H40N8O3 |
| Molecular Weight | 897.01 g/mol |
| Exact Mass | 896.32 |
| IUPAC Name | 2,5-bis[4-[[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenoxy]methyl]phenyl]-1,3,4-oxadiazole |
| SMILES | c1ccc(-c2cc(-c3ccc(OCc4ccc(-c5nnc(-c6ccc(COc7ccc(-c8cc(-c9ccccn9)nc(-c9ccccn9)c8)cc7)cc6)o5)cc4)cc3)cc(-c3ccccn3)n2)nc1 |
| InChI | InChI=1S/C58H40N8O3/c1-5-29-59-49(9-1)53-33-45(34-54(63-53)50-10-2-6-30-60-50)41-21-25-47(26-22-41)67-37-39-13-17-43(18-14-39)57-65-66-58(69-57)44-19-15-40(16-20-44)38-68-48-27-23-42(24-28-48)46-35-55(51-11-3-7-31-61-51)64-56(36-46)52-12-4-8-32-62-52/h1-36H,37-38H2 |
| InChIKey | ZFEKVGZYEBPJEY-UHFFFAOYSA-N |
| XLogP | 12.93 |
| TPSA | 134.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.01 |
| LogP ≤ 5 | 12.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |