C26H32FN3O — CID 70842233
N-[2-[cyclohexyl(methyl)amino]ethyl]-2-[6-[4-(fluoromethyl)phenyl]indol-1-yl]acetamide (PubChem CID 70842233) has the molecular formula C26H32FN3O and a molecular weight of 421.56 g/mol. Its IUPAC name is N-[2-[cyclohexyl(methyl)amino]ethyl]-2-[6-[4-(fluoromethyl)phenyl]indol-1-yl]acetamide.
| Compound Name | N-[2-[cyclohexyl(methyl)amino]ethyl]-2-[6-[4-(fluoromethyl)phenyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 70842233 |
| Molecular Formula | C26H32FN3O |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | N-[2-[cyclohexyl(methyl)amino]ethyl]-2-[6-[4-(fluoromethyl)phenyl]indol-1-yl]acetamide |
| SMILES | CN(CCNC(=O)Cn1ccc2ccc(-c3ccc(CF)cc3)cc21)C1CCCCC1 |
| InChI | InChI=1S/C26H32FN3O/c1-29(24-5-3-2-4-6-24)16-14-28-26(31)19-30-15-13-22-11-12-23(17-25(22)30)21-9-7-20(18-27)8-10-21/h7-13,15,17,24H,2-6,14,16,18-19H2,1H3,(H,28,31) |
| InChIKey | HKQKTNIEZSFNDJ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |