C27H36N4O — CID 68706287
N-[2-(cyclohexylmethylamino)ethyl]-2-[6-[4-(dimethylamino)phenyl]indol-1-yl]acetamide (PubChem CID 68706287) has the molecular formula C27H36N4O and a molecular weight of 432.61 g/mol. Its IUPAC name is N-[2-(cyclohexylmethylamino)ethyl]-2-[6-[4-(dimethylamino)phenyl]indol-1-yl]acetamide.
| Compound Name | N-[2-(cyclohexylmethylamino)ethyl]-2-[6-[4-(dimethylamino)phenyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 68706287 |
| Molecular Formula | C27H36N4O |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | N-[2-(cyclohexylmethylamino)ethyl]-2-[6-[4-(dimethylamino)phenyl]indol-1-yl]acetamide |
| SMILES | CN(C)c1ccc(-c2ccc3ccn(CC(=O)NCCNCC4CCCCC4)c3c2)cc1 |
| InChI | InChI=1S/C27H36N4O/c1-30(2)25-12-10-22(11-13-25)24-9-8-23-14-17-31(26(23)18-24)20-27(32)29-16-15-28-19-21-6-4-3-5-7-21/h8-14,17-18,21,28H,3-7,15-16,19-20H2,1-2H3,(H,29,32) |
| InChIKey | CSKKUQMWTZTDIK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 49.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|