C29H34N6O — CID 68707253
N-[2-(cyclohexylmethylamino)ethyl]-2-[6-(4-methylphenyl)-3-pyrimidin-5-ylindazol-1-yl]acetamide (PubChem CID 68707253) has the molecular formula C29H34N6O and a molecular weight of 482.63 g/mol. Its IUPAC name is N-[2-(cyclohexylmethylamino)ethyl]-2-[6-(4-methylphenyl)-3-pyrimidin-5-ylindazol-1-yl]acetamide.
| Compound Name | N-[2-(cyclohexylmethylamino)ethyl]-2-[6-(4-methylphenyl)-3-pyrimidin-5-ylindazol-1-yl]acetamide |
|---|---|
| PubChem CID | 68707253 |
| Molecular Formula | C29H34N6O |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.28 |
| IUPAC Name | N-[2-(cyclohexylmethylamino)ethyl]-2-[6-(4-methylphenyl)-3-pyrimidin-5-ylindazol-1-yl]acetamide |
| SMILES | Cc1ccc(-c2ccc3c(-c4cncnc4)nn(CC(=O)NCCNCC4CCCCC4)c3c2)cc1 |
| InChI | InChI=1S/C29H34N6O/c1-21-7-9-23(10-8-21)24-11-12-26-27(15-24)35(34-29(26)25-17-31-20-32-18-25)19-28(36)33-14-13-30-16-22-5-3-2-4-6-22/h7-12,15,17-18,20,22,30H,2-6,13-14,16,19H2,1H3,(H,33,36) |
| InChIKey | VJXCVRKJJQPXBP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|