C25H35N5O3 — CID 68545421
N-[2-(cyclooctylmethylamino)ethyl]-2-(8-methoxy-5-methyl-4-oxopyrazolo[4,5-c]quinolin-1-yl)acetamide (PubChem CID 68545421) has the molecular formula C25H35N5O3 and a molecular weight of 453.59 g/mol. Its IUPAC name is N-[2-(cyclooctylmethylamino)ethyl]-2-(8-methoxy-5-methyl-4-oxopyrazolo[4,5-c]quinolin-1-yl)acetamide.
| Compound Name | N-[2-(cyclooctylmethylamino)ethyl]-2-(8-methoxy-5-methyl-4-oxopyrazolo[4,5-c]quinolin-1-yl)acetamide |
|---|---|
| PubChem CID | 68545421 |
| Molecular Formula | C25H35N5O3 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | N-[2-(cyclooctylmethylamino)ethyl]-2-(8-methoxy-5-methyl-4-oxopyrazolo[4,5-c]quinolin-1-yl)acetamide |
| SMILES | COc1ccc2c(c1)c1c(cnn1CC(=O)NCCNCC1CCCCCCC1)c(=O)n2C |
| InChI | InChI=1S/C25H35N5O3/c1-29-22-11-10-19(33-2)14-20(22)24-21(25(29)32)16-28-30(24)17-23(31)27-13-12-26-15-18-8-6-4-3-5-7-9-18/h10-11,14,16,18,26H,3-9,12-13,15,17H2,1-2H3,(H,27,31) |
| InChIKey | ZLTRFMARBSDVRJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|