C24H33N5O3 — CID 68542137
N-[2-(cyclohexylmethylamino)ethyl]-2-(5-ethyl-8-methoxy-4-oxopyrazolo[4,5-c]quinolin-1-yl)acetamide (PubChem CID 68542137) has the molecular formula C24H33N5O3 and a molecular weight of 439.56 g/mol. Its IUPAC name is N-[2-(cyclohexylmethylamino)ethyl]-2-(5-ethyl-8-methoxy-4-oxopyrazolo[4,5-c]quinolin-1-yl)acetamide.
| Compound Name | N-[2-(cyclohexylmethylamino)ethyl]-2-(5-ethyl-8-methoxy-4-oxopyrazolo[4,5-c]quinolin-1-yl)acetamide |
|---|---|
| PubChem CID | 68542137 |
| Molecular Formula | C24H33N5O3 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | N-[2-(cyclohexylmethylamino)ethyl]-2-(5-ethyl-8-methoxy-4-oxopyrazolo[4,5-c]quinolin-1-yl)acetamide |
| SMILES | CCn1c(=O)c2cnn(CC(=O)NCCNCC3CCCCC3)c2c2cc(OC)ccc21 |
| InChI | InChI=1S/C24H33N5O3/c1-3-28-21-10-9-18(32-2)13-19(21)23-20(24(28)31)15-27-29(23)16-22(30)26-12-11-25-14-17-7-5-4-6-8-17/h9-10,13,15,17,25H,3-8,11-12,14,16H2,1-2H3,(H,26,30) |
| InChIKey | HVHRYJRBYJOGNV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|