C28H35N3O3 — CID 68709841
methyl 1-[2-[2-(cyclohexylmethylamino)ethylamino]-2-oxoethyl]-6-(4-methylphenyl)indole-2-carboxylate (PubChem CID 68709841) has the molecular formula C28H35N3O3 and a molecular weight of 461.61 g/mol. Its IUPAC name is methyl 1-[2-[2-(cyclohexylmethylamino)ethylamino]-2-oxoethyl]-6-(4-methylphenyl)indole-2-carboxylate.
| Compound Name | methyl 1-[2-[2-(cyclohexylmethylamino)ethylamino]-2-oxoethyl]-6-(4-methylphenyl)indole-2-carboxylate |
|---|---|
| PubChem CID | 68709841 |
| Molecular Formula | C28H35N3O3 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.27 |
| IUPAC Name | methyl 1-[2-[2-(cyclohexylmethylamino)ethylamino]-2-oxoethyl]-6-(4-methylphenyl)indole-2-carboxylate |
| SMILES | COC(=O)c1cc2ccc(-c3ccc(C)cc3)cc2n1CC(=O)NCCNCC1CCCCC1 |
| InChI | InChI=1S/C28H35N3O3/c1-20-8-10-22(11-9-20)23-12-13-24-17-26(28(33)34-2)31(25(24)16-23)19-27(32)30-15-14-29-18-21-6-4-3-5-7-21/h8-13,16-17,21,29H,3-7,14-15,18-19H2,1-2H3,(H,30,32) |
| InChIKey | MTGJQFVIIPOXKF-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|