C28H35N4O+ — CID 91372295
N-[2-(cyclohexylmethylamino)ethyl]-2-[5-(1H-indol-6-yl)-1-methylindol-1-ium-1-yl]acetamide (PubChem CID 91372295) has the molecular formula C28H35N4O+ and a molecular weight of 443.62 g/mol. Its IUPAC name is N-[2-(cyclohexylmethylamino)ethyl]-2-[5-(1H-indol-6-yl)-1-methylindol-1-ium-1-yl]acetamide.
| Compound Name | N-[2-(cyclohexylmethylamino)ethyl]-2-[5-(1H-indol-6-yl)-1-methylindol-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 91372295 |
| Molecular Formula | C28H35N4O+ |
| Molecular Weight | 443.62 g/mol |
| Exact Mass | 443.28 |
| IUPAC Name | N-[2-(cyclohexylmethylamino)ethyl]-2-[5-(1H-indol-6-yl)-1-methylindol-1-ium-1-yl]acetamide |
| SMILES | C[N+]1(CC(=O)NCCNCC2CCCCC2)C=Cc2cc(-c3ccc4cc[nH]c4c3)ccc21 |
| InChI | InChI=1S/C28H34N4O/c1-32(20-28(33)31-15-14-29-19-21-5-3-2-4-6-21)16-12-25-17-23(9-10-27(25)32)24-8-7-22-11-13-30-26(22)18-24/h7-13,16-18,21,29-30H,2-6,14-15,19-20H2,1H3/p+1 |
| InChIKey | OIJWTSBGDFXFAK-UHFFFAOYSA-O |
| XLogP | 5.04 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.62 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|