C25H30FN3O — CID 68710826
N-[2-(cyclohexylmethylamino)ethyl]-2-[7-(3-fluorophenyl)indol-1-yl]acetamide (PubChem CID 68710826) has the molecular formula C25H30FN3O and a molecular weight of 407.53 g/mol. Its IUPAC name is N-[2-(cyclohexylmethylamino)ethyl]-2-[7-(3-fluorophenyl)indol-1-yl]acetamide.
| Compound Name | N-[2-(cyclohexylmethylamino)ethyl]-2-[7-(3-fluorophenyl)indol-1-yl]acetamide |
|---|---|
| PubChem CID | 68710826 |
| Molecular Formula | C25H30FN3O |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | N-[2-(cyclohexylmethylamino)ethyl]-2-[7-(3-fluorophenyl)indol-1-yl]acetamide |
| SMILES | O=C(Cn1ccc2cccc(-c3cccc(F)c3)c21)NCCNCC1CCCCC1 |
| InChI | InChI=1S/C25H30FN3O/c26-22-10-4-9-21(16-22)23-11-5-8-20-12-15-29(25(20)23)18-24(30)28-14-13-27-17-19-6-2-1-3-7-19/h4-5,8-12,15-16,19,27H,1-3,6-7,13-14,17-18H2,(H,28,30) |
| InChIKey | QVWIFUKUKFTZNY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|