C29H31N3O3 — CID 143893700
N-(cyclohexylmethyl)-1-[(5-phenyl-2-pyridinyl)methyl]indole-7-carboxamide;formic acid (PubChem CID 143893700) has the molecular formula C29H31N3O3 and a molecular weight of 469.59 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-1-[(5-phenyl-2-pyridinyl)methyl]indole-7-carboxamide;formic acid.
| Compound Name | N-(cyclohexylmethyl)-1-[(5-phenyl-2-pyridinyl)methyl]indole-7-carboxamide;formic acid |
|---|---|
| PubChem CID | 143893700 |
| Molecular Formula | C29H31N3O3 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | N-(cyclohexylmethyl)-1-[(5-phenyl-2-pyridinyl)methyl]indole-7-carboxamide;formic acid |
| SMILES | O=C(NCC1CCCCC1)c1cccc2ccn(Cc3ccc(-c4ccccc4)cn3)c12.O=CO |
| InChI | InChI=1S/C28H29N3O.CH2O2/c32-28(30-18-21-8-3-1-4-9-21)26-13-7-12-23-16-17-31(27(23)26)20-25-15-14-24(19-29-25)22-10-5-2-6-11-22;2-1-3/h2,5-7,10-17,19,21H,1,3-4,8-9,18,20H2,(H,30,32);1H,(H,2,3) |
| InChIKey | BCUFGYVIDHGXTA-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|