C30H32ClN3O3 — CID 143893667
5-chloro-N-[[4-[hydroxy(methoxy)methyl]cyclohexyl]methyl]-1-[(5-phenyl-2-pyridinyl)methyl]indole-7-carboxamide (PubChem CID 143893667) has the molecular formula C30H32ClN3O3 and a molecular weight of 518.06 g/mol. Its IUPAC name is 5-chloro-N-[[4-[hydroxy(methoxy)methyl]cyclohexyl]methyl]-1-[(5-phenyl-2-pyridinyl)methyl]indole-7-carboxamide.
| Compound Name | 5-chloro-N-[[4-[hydroxy(methoxy)methyl]cyclohexyl]methyl]-1-[(5-phenyl-2-pyridinyl)methyl]indole-7-carboxamide |
|---|---|
| PubChem CID | 143893667 |
| Molecular Formula | C30H32ClN3O3 |
| Molecular Weight | 518.06 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | 5-chloro-N-[[4-[hydroxy(methoxy)methyl]cyclohexyl]methyl]-1-[(5-phenyl-2-pyridinyl)methyl]indole-7-carboxamide |
| SMILES | COC(O)C1CCC(CNC(=O)c2cc(Cl)cc3ccn(Cc4ccc(-c5ccccc5)cn4)c23)CC1 |
| InChI | InChI=1S/C30H32ClN3O3/c1-37-30(36)22-9-7-20(8-10-22)17-33-29(35)27-16-25(31)15-23-13-14-34(28(23)27)19-26-12-11-24(18-32-26)21-5-3-2-4-6-21/h2-6,11-16,18,20,22,30,36H,7-10,17,19H2,1H3,(H,33,35) |
| InChIKey | DFHSODICIDJDHS-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.06 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|