C30H33ClN2O3 — CID 143893703
5-chloro-N-(cyclohexylmethyl)-1-[(4-phenylphenyl)methyl]-2,3-dihydroindole-7-carboxamide;formic acid (PubChem CID 143893703) has the molecular formula C30H33ClN2O3 and a molecular weight of 505.06 g/mol. Its IUPAC name is 5-chloro-N-(cyclohexylmethyl)-1-[(4-phenylphenyl)methyl]-2,3-dihydroindole-7-carboxamide;formic acid.
| Compound Name | 5-chloro-N-(cyclohexylmethyl)-1-[(4-phenylphenyl)methyl]-2,3-dihydroindole-7-carboxamide;formic acid |
|---|---|
| PubChem CID | 143893703 |
| Molecular Formula | C30H33ClN2O3 |
| Molecular Weight | 505.06 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | 5-chloro-N-(cyclohexylmethyl)-1-[(4-phenylphenyl)methyl]-2,3-dihydroindole-7-carboxamide;formic acid |
| SMILES | O=C(NCC1CCCCC1)c1cc(Cl)cc2c1N(Cc1ccc(-c3ccccc3)cc1)CC2.O=CO |
| InChI | InChI=1S/C29H31ClN2O.CH2O2/c30-26-17-25-15-16-32(20-22-11-13-24(14-12-22)23-9-5-2-6-10-23)28(25)27(18-26)29(33)31-19-21-7-3-1-4-8-21;2-1-3/h2,5-6,9-14,17-18,21H,1,3-4,7-8,15-16,19-20H2,(H,31,33);1H,(H,2,3) |
| InChIKey | DGTSNCURWXJJCM-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.06 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|