C24H28Cl2N2O3 — CID 143893743
5-chloro-1-[(4-chlorophenyl)methyl]-N-(cyclohexylmethyl)-2,3-dihydroindole-7-carboxamide;formic acid (PubChem CID 143893743) has the molecular formula C24H28Cl2N2O3 and a molecular weight of 463.41 g/mol. Its IUPAC name is 5-chloro-1-[(4-chlorophenyl)methyl]-N-(cyclohexylmethyl)-2,3-dihydroindole-7-carboxamide;formic acid.
| Compound Name | 5-chloro-1-[(4-chlorophenyl)methyl]-N-(cyclohexylmethyl)-2,3-dihydroindole-7-carboxamide;formic acid |
|---|---|
| PubChem CID | 143893743 |
| Molecular Formula | C24H28Cl2N2O3 |
| Molecular Weight | 463.41 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 5-chloro-1-[(4-chlorophenyl)methyl]-N-(cyclohexylmethyl)-2,3-dihydroindole-7-carboxamide;formic acid |
| SMILES | O=C(NCC1CCCCC1)c1cc(Cl)cc2c1N(Cc1ccc(Cl)cc1)CC2.O=CO |
| InChI | InChI=1S/C23H26Cl2N2O.CH2O2/c24-19-8-6-17(7-9-19)15-27-11-10-18-12-20(25)13-21(22(18)27)23(28)26-14-16-4-2-1-3-5-16;2-1-3/h6-9,12-13,16H,1-5,10-11,14-15H2,(H,26,28);1H,(H,2,3) |
| InChIKey | XAUMRHDSLNWVCL-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.41 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|