C15H26N2O — CID 70847455
3-[[6-(2,2-dimethylpropyl)-2-pyridinyl]oxy]-N,N-dimethylpropan-1-amine (PubChem CID 70847455) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is 3-[[6-(2,2-dimethylpropyl)-2-pyridinyl]oxy]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[[6-(2,2-dimethylpropyl)-2-pyridinyl]oxy]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 70847455 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | 3-[[6-(2,2-dimethylpropyl)-2-pyridinyl]oxy]-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCOc1cccc(CC(C)(C)C)n1 |
| InChI | InChI=1S/C15H26N2O/c1-15(2,3)12-13-8-6-9-14(16-13)18-11-7-10-17(4)5/h6,8-9H,7,10-12H2,1-5H3 |
| InChIKey | SMCRAUABQCJLQC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|