C9H9F2NO2 — CID 7084789
(3S)-3-azaniumyl-3-(3,5-difluorophenyl)propanoate (PubChem CID 7084789) has the molecular formula C9H9F2NO2 and a molecular weight of 201.17 g/mol. Its IUPAC name is (3S)-3-azaniumyl-3-(3,5-difluorophenyl)propanoate.
| Compound Name | (3S)-3-azaniumyl-3-(3,5-difluorophenyl)propanoate |
|---|---|
| PubChem CID | 7084789 |
| Molecular Formula | C9H9F2NO2 |
| Molecular Weight | 201.17 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | (3S)-3-azaniumyl-3-(3,5-difluorophenyl)propanoate |
| SMILES | [NH3+][C@@H](CC(=O)[O-])c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C9H9F2NO2/c10-6-1-5(2-7(11)3-6)8(12)4-9(13)14/h1-3,8H,4,12H2,(H,13,14)/t8-/m0/s1 |
| InChIKey | OYIOVKBLAKVZEC-QMMMGPOBSA-N |
| XLogP | -0.61 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.17 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |