C20H25NO — CID 70849636
1-[2,2-diphenylethyl(propan-2-yl)amino]propan-2-one (PubChem CID 70849636) has the molecular formula C20H25NO and a molecular weight of 295.43 g/mol. Its IUPAC name is 1-[2,2-diphenylethyl(propan-2-yl)amino]propan-2-one.
| Compound Name | 1-[2,2-diphenylethyl(propan-2-yl)amino]propan-2-one |
|---|---|
| PubChem CID | 70849636 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 1-[2,2-diphenylethyl(propan-2-yl)amino]propan-2-one |
| SMILES | CC(=O)CN(CC(c1ccccc1)c1ccccc1)C(C)C |
| InChI | InChI=1S/C20H25NO/c1-16(2)21(14-17(3)22)15-20(18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-13,16,20H,14-15H2,1-3H3 |
| InChIKey | OMSKZPKEVGVFOK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |