C13H17F3N3O3+ — CID 7085021
(2S)-1,1,1-trifluoro-3-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]propan-2-ol (PubChem CID 7085021) has the molecular formula C13H17F3N3O3+ and a molecular weight of 320.29 g/mol. Its IUPAC name is (2S)-1,1,1-trifluoro-3-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]propan-2-ol.
| Compound Name | (2S)-1,1,1-trifluoro-3-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 7085021 |
| Molecular Formula | C13H17F3N3O3+ |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | (2S)-1,1,1-trifluoro-3-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]propan-2-ol |
| SMILES | O=[N+]([O-])c1ccc(N2CC[NH+](C[C@H](O)C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C13H16F3N3O3/c14-13(15,16)12(20)9-17-5-7-18(8-6-17)10-1-3-11(4-2-10)19(21)22/h1-4,12,20H,5-9H2/p+1/t12-/m0/s1 |
| InChIKey | PKYYLZODOGXZMK-LBPRGKRZSA-O |
| XLogP | 0.22 |
| TPSA | 71.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|