C27H39N3O3 — CID 70850439
ethyl 7-[(1-cyclohexyl-4,5,6,7,8,9-hexahydrocycloocta[d]pyrazole-3-carbonyl)amino]tricyclo[4.2.0.01,3]octane-7-carboxylate (PubChem CID 70850439) has the molecular formula C27H39N3O3 and a molecular weight of 453.63 g/mol. Its IUPAC name is ethyl 7-[(1-cyclohexyl-4,5,6,7,8,9-hexahydrocycloocta[d]pyrazole-3-carbonyl)amino]tricyclo[4.2.0.01,3]octane-7-carboxylate.
| Compound Name | ethyl 7-[(1-cyclohexyl-4,5,6,7,8,9-hexahydrocycloocta[d]pyrazole-3-carbonyl)amino]tricyclo[4.2.0.01,3]octane-7-carboxylate |
|---|---|
| PubChem CID | 70850439 |
| Molecular Formula | C27H39N3O3 |
| Molecular Weight | 453.63 g/mol |
| Exact Mass | 453.30 |
| IUPAC Name | ethyl 7-[(1-cyclohexyl-4,5,6,7,8,9-hexahydrocycloocta[d]pyrazole-3-carbonyl)amino]tricyclo[4.2.0.01,3]octane-7-carboxylate |
| SMILES | CCOC(=O)C1(NC(=O)c2nn(C3CCCCC3)c3c2CCCCCC3)CC23CC2CCC13 |
| InChI | InChI=1S/C27H39N3O3/c1-2-33-25(32)27(17-26-16-18(26)14-15-22(26)27)28-24(31)23-20-12-8-3-4-9-13-21(20)30(29-23)19-10-6-5-7-11-19/h18-19,22H,2-17H2,1H3,(H,28,31) |
| InChIKey | KOBYHQHWNTVPPC-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.63 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |