C26H21F3N4O2 — CID 70853123
N-(2-morpholin-4-yl-4-pyridinyl)-8-[3-(trifluoromethyl)phenyl]quinoline-2-carboxamide (PubChem CID 70853123) has the molecular formula C26H21F3N4O2 and a molecular weight of 478.47 g/mol. Its IUPAC name is N-(2-morpholin-4-yl-4-pyridinyl)-8-[3-(trifluoromethyl)phenyl]quinoline-2-carboxamide.
| Compound Name | N-(2-morpholin-4-yl-4-pyridinyl)-8-[3-(trifluoromethyl)phenyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 70853123 |
| Molecular Formula | C26H21F3N4O2 |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | N-(2-morpholin-4-yl-4-pyridinyl)-8-[3-(trifluoromethyl)phenyl]quinoline-2-carboxamide |
| SMILES | O=C(Nc1ccnc(N2CCOCC2)c1)c1ccc2cccc(-c3cccc(C(F)(F)F)c3)c2n1 |
| InChI | InChI=1S/C26H21F3N4O2/c27-26(28,29)19-5-1-4-18(15-19)21-6-2-3-17-7-8-22(32-24(17)21)25(34)31-20-9-10-30-23(16-20)33-11-13-35-14-12-33/h1-10,15-16H,11-14H2,(H,30,31,34) |
| InChIKey | TXHUZQUMRAKUPB-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |