C26H21F3N4O — CID 70853301
N-(6-pyrrolidin-1-yl-2-pyridinyl)-8-[3-(trifluoromethyl)phenyl]quinoline-2-carboxamide (PubChem CID 70853301) has the molecular formula C26H21F3N4O and a molecular weight of 462.48 g/mol. Its IUPAC name is N-(6-pyrrolidin-1-yl-2-pyridinyl)-8-[3-(trifluoromethyl)phenyl]quinoline-2-carboxamide.
| Compound Name | N-(6-pyrrolidin-1-yl-2-pyridinyl)-8-[3-(trifluoromethyl)phenyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 70853301 |
| Molecular Formula | C26H21F3N4O |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | N-(6-pyrrolidin-1-yl-2-pyridinyl)-8-[3-(trifluoromethyl)phenyl]quinoline-2-carboxamide |
| SMILES | O=C(Nc1cccc(N2CCCC2)n1)c1ccc2cccc(-c3cccc(C(F)(F)F)c3)c2n1 |
| InChI | InChI=1S/C26H21F3N4O/c27-26(28,29)19-8-3-7-18(16-19)20-9-4-6-17-12-13-21(30-24(17)20)25(34)32-22-10-5-11-23(31-22)33-14-1-2-15-33/h3-13,16H,1-2,14-15H2,(H,31,32,34) |
| InChIKey | BBLCCVAIUQUFJF-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |