C21H15F3N4 — CID 70852923
N-[[8-[3-(trifluoromethyl)phenyl]quinolin-2-yl]methyl]pyrazin-2-amine (PubChem CID 70852923) has the molecular formula C21H15F3N4 and a molecular weight of 380.37 g/mol. Its IUPAC name is N-[[8-[3-(trifluoromethyl)phenyl]quinolin-2-yl]methyl]pyrazin-2-amine.
| Compound Name | N-[[8-[3-(trifluoromethyl)phenyl]quinolin-2-yl]methyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 70852923 |
| Molecular Formula | C21H15F3N4 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | N-[[8-[3-(trifluoromethyl)phenyl]quinolin-2-yl]methyl]pyrazin-2-amine |
| SMILES | FC(F)(F)c1cccc(-c2cccc3ccc(CNc4cnccn4)nc23)c1 |
| InChI | InChI=1S/C21H15F3N4/c22-21(23,24)16-5-1-4-15(11-16)18-6-2-3-14-7-8-17(28-20(14)18)12-27-19-13-25-9-10-26-19/h1-11,13H,12H2,(H,26,27) |
| InChIKey | SNTSAXTWFJINII-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |