C12H11FIN3O5 — CID 70853210
3-[3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-iodo-8H-pyrido[2,3-d]pyrimidine-2,7-dione (PubChem CID 70853210) has the molecular formula C12H11FIN3O5 and a molecular weight of 423.14 g/mol. Its IUPAC name is 3-[3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-iodo-8H-pyrido[2,3-d]pyrimidine-2,7-dione.
| Compound Name | 3-[3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-iodo-8H-pyrido[2,3-d]pyrimidine-2,7-dione |
|---|---|
| PubChem CID | 70853210 |
| Molecular Formula | C12H11FIN3O5 |
| Molecular Weight | 423.14 g/mol |
| Exact Mass | 422.97 |
| IUPAC Name | 3-[3-fluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-iodo-8H-pyrido[2,3-d]pyrimidine-2,7-dione |
| SMILES | O=c1[nH]c2nc(=O)n(C3OC(CO)C(O)C3F)cc2cc1I |
| InChI | InChI=1S/C12H11FIN3O5/c13-7-8(19)6(3-18)22-11(7)17-2-4-1-5(14)10(20)15-9(4)16-12(17)21/h1-2,6-8,11,18-19H,3H2,(H,15,16,20,21) |
| InChIKey | ILMBVGMDOCNYIS-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 117.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.14 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|