C14H17N3O5 — CID 132554836
6-cyclopropyl-3-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7H-pyrrolo[2,3-d]pyrimidin-2-one (PubChem CID 132554836) has the molecular formula C14H17N3O5 and a molecular weight of 307.31 g/mol. Its IUPAC name is 6-cyclopropyl-3-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7H-pyrrolo[2,3-d]pyrimidin-2-one.
| Compound Name | 6-cyclopropyl-3-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7H-pyrrolo[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 132554836 |
| Molecular Formula | C14H17N3O5 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 6-cyclopropyl-3-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7H-pyrrolo[2,3-d]pyrimidin-2-one |
| SMILES | O=c1nc2[nH]c(C3CC3)cc2cn1[C@@H]1O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H17N3O5/c18-5-9-10(19)11(20)13(22-9)17-4-7-3-8(6-1-2-6)15-12(7)16-14(17)21/h3-4,6,9-11,13,18-20H,1-2,5H2,(H,15,16,21)/t9-,10-,11+,13-/m1/s1 |
| InChIKey | GOWSSUGLRDVRMK-HNCHTBHHSA-N |
| XLogP | -0.79 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |