C19H28N4O8 — CID 162377470
tert-butyl N-[2-[[3-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-6-yl]methoxy]ethyl]carbamate (PubChem CID 162377470) has the molecular formula C19H28N4O8 and a molecular weight of 440.45 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-6-yl]methoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-6-yl]methoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 162377470 |
| Molecular Formula | C19H28N4O8 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | tert-butyl N-[2-[[3-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-6-yl]methoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOCc1cc2cn([C@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c(=O)nc2[nH]1 |
| InChI | InChI=1S/C19H28N4O8/c1-19(2,3)31-18(28)20-4-5-29-9-11-6-10-7-23(17(27)22-15(10)21-11)16-14(26)13(25)12(8-24)30-16/h6-7,12-14,16,24-26H,4-5,8-9H2,1-3H3,(H,20,28)(H,21,22,27)/t12-,13-,14-,16+/m1/s1 |
| InChIKey | NODKZLXSYPQCPE-KQTLUZQSSA-N |
| XLogP | -0.62 |
| TPSA | 168.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|