C13H14FN3O6 — CID 118004796
3-[(2R,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-fluoro-6-methyl-8H-pyrido[2,3-d]pyrimidine-2,5-dione (PubChem CID 118004796) has the molecular formula C13H14FN3O6 and a molecular weight of 327.27 g/mol. Its IUPAC name is 3-[(2R,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-fluoro-6-methyl-8H-pyrido[2,3-d]pyrimidine-2,5-dione.
| Compound Name | 3-[(2R,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-fluoro-6-methyl-8H-pyrido[2,3-d]pyrimidine-2,5-dione |
|---|---|
| PubChem CID | 118004796 |
| Molecular Formula | C13H14FN3O6 |
| Molecular Weight | 327.27 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 3-[(2R,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7-fluoro-6-methyl-8H-pyrido[2,3-d]pyrimidine-2,5-dione |
| SMILES | Cc1c(F)[nH]c2nc(=O)n([C@@H]3O[C@H](CO)C(O)[C@@H]3O)cc2c1=O |
| InChI | InChI=1S/C13H14FN3O6/c1-4-7(19)5-2-17(13(22)16-11(5)15-10(4)14)12-9(21)8(20)6(3-18)23-12/h2,6,8-9,12,18,20-21H,3H2,1H3,(H,15,16,22)/t6-,8?,9+,12-/m1/s1 |
| InChIKey | VKLBLEVEPNIBEY-WURNFRPNSA-N |
| XLogP | -1.86 |
| TPSA | 137.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.27 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|