C12H11F2N3O5S — CID 118004819
3-[(2R,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6,7-difluoro-2-sulfanylidene-8H-pyrido[2,3-d]pyrimidin-5-one (PubChem CID 118004819) has the molecular formula C12H11F2N3O5S and a molecular weight of 347.30 g/mol. Its IUPAC name is 3-[(2R,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6,7-difluoro-2-sulfanylidene-8H-pyrido[2,3-d]pyrimidin-5-one.
| Compound Name | 3-[(2R,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6,7-difluoro-2-sulfanylidene-8H-pyrido[2,3-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 118004819 |
| Molecular Formula | C12H11F2N3O5S |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 3-[(2R,3S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6,7-difluoro-2-sulfanylidene-8H-pyrido[2,3-d]pyrimidin-5-one |
| SMILES | O=c1c(F)c(F)[nH]c2nc(=S)n([C@@H]3O[C@H](CO)C(O)[C@@H]3O)cc12 |
| InChI | InChI=1S/C12H11F2N3O5S/c13-5-6(19)3-1-17(12(23)16-10(3)15-9(5)14)11-8(21)7(20)4(2-18)22-11/h1,4,7-8,11,18,20-21H,2H2,(H,15,16,23)/t4-,7?,8+,11-/m1/s1 |
| InChIKey | BLTGDMJRFAXQQQ-MDIMCQLDSA-N |
| XLogP | -0.66 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|