C11H12FN3O4S — CID 144823627
3-[(2R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-fluoro-7H-pyrrolo[2,3-d]pyrimidine-2-thione (PubChem CID 144823627) has the molecular formula C11H12FN3O4S and a molecular weight of 301.30 g/mol. Its IUPAC name is 3-[(2R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-fluoro-7H-pyrrolo[2,3-d]pyrimidine-2-thione.
| Compound Name | 3-[(2R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-fluoro-7H-pyrrolo[2,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 144823627 |
| Molecular Formula | C11H12FN3O4S |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 3-[(2R,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-fluoro-7H-pyrrolo[2,3-d]pyrimidine-2-thione |
| SMILES | OC[C@H]1O[C@@H](n2cc3cc(F)[nH]c3nc2=S)C(O)C1O |
| InChI | InChI=1S/C11H12FN3O4S/c12-6-1-4-2-15(11(20)14-9(4)13-6)10-8(18)7(17)5(3-16)19-10/h1-2,5,7-8,10,16-18H,3H2,(H,13,14,20)/t5-,7?,8?,10-/m1/s1 |
| InChIKey | NGSSGKOLTNWNKB-AFBKUMPFSA-N |
| XLogP | -0.16 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|