C11H11FN4O5S — CID 123186090
3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-fluoro-2-sulfanylidene-8H-pteridin-7-one (PubChem CID 123186090) has the molecular formula C11H11FN4O5S and a molecular weight of 330.30 g/mol. Its IUPAC name is 3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-fluoro-2-sulfanylidene-8H-pteridin-7-one.
| Compound Name | 3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-fluoro-2-sulfanylidene-8H-pteridin-7-one |
|---|---|
| PubChem CID | 123186090 |
| Molecular Formula | C11H11FN4O5S |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-fluoro-2-sulfanylidene-8H-pteridin-7-one |
| SMILES | O=c1[nH]c2nc(=S)n(C3OC(CO)C(O)C3O)cc2nc1F |
| InChI | InChI=1S/C11H11FN4O5S/c12-7-9(20)14-8-3(13-7)1-16(11(22)15-8)10-6(19)5(18)4(2-17)21-10/h1,4-6,10,17-19H,2H2,(H,14,15,20,22) |
| InChIKey | HQVALUSNNCSCSV-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|