C12H18N3O13P3S — CID 122543502
[[(2R,4S,5R)-3,4-dihydroxy-5-(6-methyl-2-sulfanylidene-7H-pyrrolo[2,3-d]pyrimidin-3-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 122543502) has the molecular formula C12H18N3O13P3S and a molecular weight of 537.27 g/mol. Its IUPAC name is [[(2R,4S,5R)-3,4-dihydroxy-5-(6-methyl-2-sulfanylidene-7H-pyrrolo[2,3-d]pyrimidin-3-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,4S,5R)-3,4-dihydroxy-5-(6-methyl-2-sulfanylidene-7H-pyrrolo[2,3-d]pyrimidin-3-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 122543502 |
| Molecular Formula | C12H18N3O13P3S |
| Molecular Weight | 537.27 g/mol |
| Exact Mass | 536.98 |
| IUPAC Name | [[(2R,4S,5R)-3,4-dihydroxy-5-(6-methyl-2-sulfanylidene-7H-pyrrolo[2,3-d]pyrimidin-3-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Cc1cc2cn([C@@H]3O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)[C@@H]3O)c(=S)nc2[nH]1 |
| InChI | InChI=1S/C12H18N3O13P3S/c1-5-2-6-3-15(12(32)14-10(6)13-5)11-9(17)8(16)7(26-11)4-25-30(21,22)28-31(23,24)27-29(18,19)20/h2-3,7-9,11,16-17H,4H2,1H3,(H,21,22)(H,23,24)(H,13,14,32)(H2,18,19,20)/t7-,8?,9+,11-/m1/s1 |
| InChIKey | KEAPGEKITWJIPU-IPILIZDMSA-N |
| XLogP | 0.36 |
| TPSA | 243.12 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.27 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|