C28H36N2O9 — CID 70854704
[(3R,5S,6R,7S,10R,11S,12Z,14E)-5,11,21-trimethoxy-3,7,15-trimethyl-16,20,22-trioxo-23-oxa-17-azatricyclo[16.3.1.16,9]tricosa-1(21),8,12,14,18-pentaen-10-yl] carbamate (PubChem CID 70854704) has the molecular formula C28H36N2O9 and a molecular weight of 544.60 g/mol. Its IUPAC name is [(3R,5S,6R,7S,10R,11S,12Z,14E)-5,11,21-trimethoxy-3,7,15-trimethyl-16,20,22-trioxo-23-oxa-17-azatricyclo[16.3.1.16,9]tricosa-1(21),8,12,14,18-pentaen-10-yl] carbamate.
| Compound Name | [(3R,5S,6R,7S,10R,11S,12Z,14E)-5,11,21-trimethoxy-3,7,15-trimethyl-16,20,22-trioxo-23-oxa-17-azatricyclo[16.3.1.16,9]tricosa-1(21),8,12,14,18-pentaen-10-yl] carbamate |
|---|---|
| PubChem CID | 70854704 |
| Molecular Formula | C28H36N2O9 |
| Molecular Weight | 544.60 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | [(3R,5S,6R,7S,10R,11S,12Z,14E)-5,11,21-trimethoxy-3,7,15-trimethyl-16,20,22-trioxo-23-oxa-17-azatricyclo[16.3.1.16,9]tricosa-1(21),8,12,14,18-pentaen-10-yl] carbamate |
| SMILES | COC1=C2C[C@@H](C)C[C@H](OC)[C@@H]3OC(=C[C@@H]3C)[C@H](OC(N)=O)[C@@H](OC)/C=C\C=C(/C)C(=O)NC(=CC1=O)C2=O |
| InChI | InChI=1S/C28H36N2O9/c1-14-10-17-23(32)18(13-19(31)25(17)37-6)30-27(33)15(2)8-7-9-20(35-4)26(39-28(29)34)22-12-16(3)24(38-22)21(11-14)36-5/h7-9,12-14,16,20-21,24,26H,10-11H2,1-6H3,(H2,29,34)(H,30,33)/b9-7-,15-8+/t14-,16+,20+,21+,24-,26-/m1/s1 |
| InChIKey | KFPGANVVQKEGLU-OGJJEULHSA-N |
| XLogP | 2.38 |
| TPSA | 152.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.60 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|