C25H32N4O2S — CID 70859443
N-[4-(3-amino-1-cyclobutyl-6-piperidin-1-ylindol-2-yl)phenyl]ethanesulfonamide (PubChem CID 70859443) has the molecular formula C25H32N4O2S and a molecular weight of 452.62 g/mol. Its IUPAC name is N-[4-(3-amino-1-cyclobutyl-6-piperidin-1-ylindol-2-yl)phenyl]ethanesulfonamide.
| Compound Name | N-[4-(3-amino-1-cyclobutyl-6-piperidin-1-ylindol-2-yl)phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 70859443 |
| Molecular Formula | C25H32N4O2S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | N-[4-(3-amino-1-cyclobutyl-6-piperidin-1-ylindol-2-yl)phenyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1ccc(-c2c(N)c3ccc(N4CCCCC4)cc3n2C2CCC2)cc1 |
| InChI | InChI=1S/C25H32N4O2S/c1-2-32(30,31)27-19-11-9-18(10-12-19)25-24(26)22-14-13-21(28-15-4-3-5-16-28)17-23(22)29(25)20-7-6-8-20/h9-14,17,20,27H,2-8,15-16,26H2,1H3 |
| InChIKey | ABQGWFPMPXJPBW-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 80.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |