C27H30N4O2S — CID 59426243
N-[4-(3-cyano-1-cyclobutyl-6-piperidin-1-ylindol-2-yl)phenyl]cyclopropanesulfonamide (PubChem CID 59426243) has the molecular formula C27H30N4O2S and a molecular weight of 474.63 g/mol. Its IUPAC name is N-[4-(3-cyano-1-cyclobutyl-6-piperidin-1-ylindol-2-yl)phenyl]cyclopropanesulfonamide.
| Compound Name | N-[4-(3-cyano-1-cyclobutyl-6-piperidin-1-ylindol-2-yl)phenyl]cyclopropanesulfonamide |
|---|---|
| PubChem CID | 59426243 |
| Molecular Formula | C27H30N4O2S |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | N-[4-(3-cyano-1-cyclobutyl-6-piperidin-1-ylindol-2-yl)phenyl]cyclopropanesulfonamide |
| SMILES | N#Cc1c(-c2ccc(NS(=O)(=O)C3CC3)cc2)n(C2CCC2)c2cc(N3CCCCC3)ccc12 |
| InChI | InChI=1S/C27H30N4O2S/c28-18-25-24-14-11-22(30-15-2-1-3-16-30)17-26(24)31(21-5-4-6-21)27(25)19-7-9-20(10-8-19)29-34(32,33)23-12-13-23/h7-11,14,17,21,23,29H,1-6,12-13,15-16H2 |
| InChIKey | AAMXREQYHIXSNI-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |