C19H31N3O4Si — CID 70861209
tert-butyl 4-(5-methoxycarbonyl-3-trimethylsilyl-2-pyridinyl)piperazine-1-carboxylate (PubChem CID 70861209) has the molecular formula C19H31N3O4Si and a molecular weight of 393.56 g/mol. Its IUPAC name is tert-butyl 4-(5-methoxycarbonyl-3-trimethylsilyl-2-pyridinyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-methoxycarbonyl-3-trimethylsilyl-2-pyridinyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 70861209 |
| Molecular Formula | C19H31N3O4Si |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | tert-butyl 4-(5-methoxycarbonyl-3-trimethylsilyl-2-pyridinyl)piperazine-1-carboxylate |
| SMILES | COC(=O)c1cnc(N2CCN(C(=O)OC(C)(C)C)CC2)c([Si](C)(C)C)c1 |
| InChI | InChI=1S/C19H31N3O4Si/c1-19(2,3)26-18(24)22-10-8-21(9-11-22)16-15(27(5,6)7)12-14(13-20-16)17(23)25-4/h12-13H,8-11H2,1-7H3 |
| InChIKey | ATLSZHKQBQDIMO-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|