C15H14N2O2S — CID 7086349
6-methoxy-N-(3-methoxyphenyl)-1,3-benzothiazol-2-amine (PubChem CID 7086349) has the molecular formula C15H14N2O2S and a molecular weight of 286.36 g/mol. Its IUPAC name is 6-methoxy-N-(3-methoxyphenyl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-methoxy-N-(3-methoxyphenyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 7086349 |
| Molecular Formula | C15H14N2O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 6-methoxy-N-(3-methoxyphenyl)-1,3-benzothiazol-2-amine |
| SMILES | COc1cccc(Nc2nc3ccc(OC)cc3s2)c1 |
| InChI | InChI=1S/C15H14N2O2S/c1-18-11-5-3-4-10(8-11)16-15-17-13-7-6-12(19-2)9-14(13)20-15/h3-9H,1-2H3,(H,16,17) |
| InChIKey | RSXZMIYAUIITMF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |