C9H8N2O2S — CID 118295558
N-(5-hydroxy-1,3-benzothiazol-2-yl)acetamide (PubChem CID 118295558) has the molecular formula C9H8N2O2S and a molecular weight of 208.24 g/mol. Its IUPAC name is N-(5-hydroxy-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | N-(5-hydroxy-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 118295558 |
| Molecular Formula | C9H8N2O2S |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | N-(5-hydroxy-1,3-benzothiazol-2-yl)acetamide |
| SMILES | CC(=O)Nc1nc2cc(O)ccc2s1 |
| InChI | InChI=1S/C9H8N2O2S/c1-5(12)10-9-11-7-4-6(13)2-3-8(7)14-9/h2-4,13H,1H3,(H,10,11,12) |
| InChIKey | YOMAHEQEXVNJNF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |