C22H26N2O3 — CID 70863616
(12aS)-9-butoxy-8-methoxy-11-methyl-12a,13-dihydro-12H-indolo[2,1-c][1,4]benzodiazepin-6-one (PubChem CID 70863616) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is (12aS)-9-butoxy-8-methoxy-11-methyl-12a,13-dihydro-12H-indolo[2,1-c][1,4]benzodiazepin-6-one.
| Compound Name | (12aS)-9-butoxy-8-methoxy-11-methyl-12a,13-dihydro-12H-indolo[2,1-c][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 70863616 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | (12aS)-9-butoxy-8-methoxy-11-methyl-12a,13-dihydro-12H-indolo[2,1-c][1,4]benzodiazepin-6-one |
| SMILES | CCCCOc1cc2c(cc1OC)C(=O)N1c3ccccc3C[C@H]1CN2C |
| InChI | InChI=1S/C22H26N2O3/c1-4-5-10-27-21-13-19-17(12-20(21)26-3)22(25)24-16(14-23(19)2)11-15-8-6-7-9-18(15)24/h6-9,12-13,16H,4-5,10-11,14H2,1-3H3/t16-/m0/s1 |
| InChIKey | ZHYFDANSNYJTHX-INIZCTEOSA-N |
| XLogP | 3.90 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|