C24H22N2O3 — CID 70863755
2,3-dihydroindol-1-yl-[4-[[3-(hydroxymethyl)phenyl]methoxy]-2-(methylideneamino)phenyl]methanone (PubChem CID 70863755) has the molecular formula C24H22N2O3 and a molecular weight of 386.45 g/mol. Its IUPAC name is 2,3-dihydroindol-1-yl-[4-[[3-(hydroxymethyl)phenyl]methoxy]-2-(methylideneamino)phenyl]methanone.
| Compound Name | 2,3-dihydroindol-1-yl-[4-[[3-(hydroxymethyl)phenyl]methoxy]-2-(methylideneamino)phenyl]methanone |
|---|---|
| PubChem CID | 70863755 |
| Molecular Formula | C24H22N2O3 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 2,3-dihydroindol-1-yl-[4-[[3-(hydroxymethyl)phenyl]methoxy]-2-(methylideneamino)phenyl]methanone |
| SMILES | C=Nc1cc(OCc2cccc(CO)c2)ccc1C(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C24H22N2O3/c1-25-22-14-20(29-16-18-6-4-5-17(13-18)15-27)9-10-21(22)24(28)26-12-11-19-7-2-3-8-23(19)26/h2-10,13-14,27H,1,11-12,15-16H2 |
| InChIKey | IIXIFYOQJNBQMB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|