C32H37F4N5O6 — CID 70864532
ethyl (2R,4S)-4-[[5-(4-ethoxy-4-oxobutoxy)pyrimidin-2-yl]-[[3-(fluoromethyl)-5-(trifluoromethyl)phenyl]methyl]amino]-2-ethyl-6-oxo-2,3,4,5-tetrahydro-1,5-naphthyridine-1-carboxylate (PubChem CID 70864532) has the molecular formula C32H37F4N5O6 and a molecular weight of 663.67 g/mol. Its IUPAC name is ethyl (2R,4S)-4-[[5-(4-ethoxy-4-oxobutoxy)pyrimidin-2-yl]-[[3-(fluoromethyl)-5-(trifluoromethyl)phenyl]methyl]amino]-2-ethyl-6-oxo-2,3,4,5-tetrahydro-1,5-naphthyridine-1-carboxylate.
| Compound Name | ethyl (2R,4S)-4-[[5-(4-ethoxy-4-oxobutoxy)pyrimidin-2-yl]-[[3-(fluoromethyl)-5-(trifluoromethyl)phenyl]methyl]amino]-2-ethyl-6-oxo-2,3,4,5-tetrahydro-1,5-naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 70864532 |
| Molecular Formula | C32H37F4N5O6 |
| Molecular Weight | 663.67 g/mol |
| Exact Mass | 663.27 |
| IUPAC Name | ethyl (2R,4S)-4-[[5-(4-ethoxy-4-oxobutoxy)pyrimidin-2-yl]-[[3-(fluoromethyl)-5-(trifluoromethyl)phenyl]methyl]amino]-2-ethyl-6-oxo-2,3,4,5-tetrahydro-1,5-naphthyridine-1-carboxylate |
| SMILES | CCOC(=O)CCCOc1cnc(N(Cc2cc(CF)cc(C(F)(F)F)c2)[C@H]2C[C@@H](CC)N(C(=O)OCC)c3ccc(=O)[nH]c32)nc1 |
| InChI | InChI=1S/C32H37F4N5O6/c1-4-23-15-26(29-25(9-10-27(42)39-29)41(23)31(44)46-6-3)40(19-21-12-20(16-33)13-22(14-21)32(34,35)36)30-37-17-24(18-38-30)47-11-7-8-28(43)45-5-2/h9-10,12-14,17-18,23,26H,4-8,11,15-16,19H2,1-3H3,(H,39,42)/t23-,26+/m1/s1 |
| InChIKey | WRUJEMLVDARBRS-BVAGGSTKSA-N |
| XLogP | 6.27 |
| TPSA | 126.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.67 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|