C32H35F6N5O6 — CID 86610665
ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(4-ethoxy-4-oxobutoxy)pyrimidin-2-yl]amino]-2-ethyl-6-oxo-2,3,4,5-tetrahydro-1,5-naphthyridine-1-carboxylate (PubChem CID 86610665) has the molecular formula C32H35F6N5O6 and a molecular weight of 699.65 g/mol. Its IUPAC name is ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(4-ethoxy-4-oxobutoxy)pyrimidin-2-yl]amino]-2-ethyl-6-oxo-2,3,4,5-tetrahydro-1,5-naphthyridine-1-carboxylate.
| Compound Name | ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(4-ethoxy-4-oxobutoxy)pyrimidin-2-yl]amino]-2-ethyl-6-oxo-2,3,4,5-tetrahydro-1,5-naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 86610665 |
| Molecular Formula | C32H35F6N5O6 |
| Molecular Weight | 699.65 g/mol |
| Exact Mass | 699.25 |
| IUPAC Name | ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(4-ethoxy-4-oxobutoxy)pyrimidin-2-yl]amino]-2-ethyl-6-oxo-2,3,4,5-tetrahydro-1,5-naphthyridine-1-carboxylate |
| SMILES | CCOC(=O)CCCOc1cnc(N[C@H]2C[C@@H](CC)N(C(=O)OCC)c3ccc(=O)[nH]c32)nc1Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C32H35F6N5O6/c1-4-21-16-23(28-24(9-10-26(44)42-28)43(21)30(46)48-6-3)41-29-39-17-25(49-11-7-8-27(45)47-5-2)22(40-29)14-18-12-19(31(33,34)35)15-20(13-18)32(36,37)38/h9-10,12-13,15,17,21,23H,4-8,11,14,16H2,1-3H3,(H,42,44)(H,39,40,41)/t21-,23+/m1/s1 |
| InChIKey | WRBCGLJTHRQYRM-GGAORHGYSA-N |
| XLogP | 6.81 |
| TPSA | 135.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.65 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|