C35H33F6N5O6 — CID 86610634
ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(4-methoxycarbonylphenoxy)pyrimidin-2-yl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate (PubChem CID 86610634) has the molecular formula C35H33F6N5O6 and a molecular weight of 733.67 g/mol. Its IUPAC name is ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(4-methoxycarbonylphenoxy)pyrimidin-2-yl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate.
| Compound Name | ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(4-methoxycarbonylphenoxy)pyrimidin-2-yl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 86610634 |
| Molecular Formula | C35H33F6N5O6 |
| Molecular Weight | 733.67 g/mol |
| Exact Mass | 733.23 |
| IUPAC Name | ethyl (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(4-methoxycarbonylphenoxy)pyrimidin-2-yl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylate |
| SMILES | CCOC(=O)N1c2ccc(OC)nc2[C@@H](Nc2ncc(Oc3ccc(C(=O)OC)cc3)c(Cc3cc(C(F)(F)F)cc(C(F)(F)F)c3)n2)C[C@H]1CC |
| InChI | InChI=1S/C35H33F6N5O6/c1-5-23-17-26(30-27(11-12-29(45-30)49-3)46(23)33(48)51-6-2)44-32-42-18-28(52-24-9-7-20(8-10-24)31(47)50-4)25(43-32)15-19-13-21(34(36,37)38)16-22(14-19)35(39,40)41/h7-14,16,18,23,26H,5-6,15,17H2,1-4H3,(H,42,43,44)/t23-,26+/m1/s1 |
| InChIKey | SCJKCOGJFKGBKW-BVAGGSTKSA-N |
| XLogP | 8.39 |
| TPSA | 125.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.67 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |