C25H22BrF6N5O3 — CID 90816367
(2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-bromopyrimidin-2-yl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylic acid (PubChem CID 90816367) has the molecular formula C25H22BrF6N5O3 and a molecular weight of 634.38 g/mol. Its IUPAC name is (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-bromopyrimidin-2-yl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylic acid.
| Compound Name | (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-bromopyrimidin-2-yl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylic acid |
|---|---|
| PubChem CID | 90816367 |
| Molecular Formula | C25H22BrF6N5O3 |
| Molecular Weight | 634.38 g/mol |
| Exact Mass | 633.08 |
| IUPAC Name | (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-bromopyrimidin-2-yl]amino]-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridine-1-carboxylic acid |
| SMILES | CC[C@@H]1C[C@H](Nc2ncc(Br)c(Cc3cc(C(F)(F)F)cc(C(F)(F)F)c3)n2)c2nc(OC)ccc2N1C(=O)O |
| InChI | InChI=1S/C25H22BrF6N5O3/c1-3-15-10-18(21-19(37(15)23(38)39)4-5-20(36-21)40-2)35-22-33-11-16(26)17(34-22)8-12-6-13(24(27,28)29)9-14(7-12)25(30,31)32/h4-7,9,11,15,18H,3,8,10H2,1-2H3,(H,38,39)(H,33,34,35)/t15-,18+/m1/s1 |
| InChIKey | QEKVLIMVKGZQEM-QAPCUYQASA-N |
| XLogP | 7.09 |
| TPSA | 100.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.38 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |