C29H27F9N4O5 — CID 91249848
(2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2,3-dihydroxypropoxy)pyrimidin-2-yl]amino]-2-ethyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylic acid (PubChem CID 91249848) has the molecular formula C29H27F9N4O5 and a molecular weight of 682.54 g/mol. Its IUPAC name is (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2,3-dihydroxypropoxy)pyrimidin-2-yl]amino]-2-ethyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylic acid.
| Compound Name | (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2,3-dihydroxypropoxy)pyrimidin-2-yl]amino]-2-ethyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylic acid |
|---|---|
| PubChem CID | 91249848 |
| Molecular Formula | C29H27F9N4O5 |
| Molecular Weight | 682.54 g/mol |
| Exact Mass | 682.18 |
| IUPAC Name | (2R,4S)-4-[[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2,3-dihydroxypropoxy)pyrimidin-2-yl]amino]-2-ethyl-6-(trifluoromethyl)-3,4-dihydro-2H-quinoline-1-carboxylic acid |
| SMILES | CC[C@@H]1C[C@H](Nc2ncc(OCC(O)CO)c(Cc3cc(C(F)(F)F)cc(C(F)(F)F)c3)n2)c2cc(C(F)(F)F)ccc2N1C(=O)O |
| InChI | InChI=1S/C29H27F9N4O5/c1-2-18-10-21(20-9-15(27(30,31)32)3-4-23(20)42(18)26(45)46)40-25-39-11-24(47-13-19(44)12-43)22(41-25)7-14-5-16(28(33,34)35)8-17(6-14)29(36,37)38/h3-6,8-9,11,18-19,21,43-44H,2,7,10,12-13H2,1H3,(H,45,46)(H,39,40,41)/t18-,19?,21+/m1/s1 |
| InChIKey | QKGGMGBTABAMJA-DRPMKMPGSA-N |
| XLogP | 6.68 |
| TPSA | 128.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.54 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |