C30H33F6N5O6S — CID 86610649
3-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-[[(2R,4S)-1-ethoxycarbonyl-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridin-4-yl]amino]pyrimidin-5-yl]propane-1-sulfonic acid (PubChem CID 86610649) has the molecular formula C30H33F6N5O6S and a molecular weight of 705.68 g/mol. Its IUPAC name is 3-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-[[(2R,4S)-1-ethoxycarbonyl-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridin-4-yl]amino]pyrimidin-5-yl]propane-1-sulfonic acid.
| Compound Name | 3-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-[[(2R,4S)-1-ethoxycarbonyl-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridin-4-yl]amino]pyrimidin-5-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 86610649 |
| Molecular Formula | C30H33F6N5O6S |
| Molecular Weight | 705.68 g/mol |
| Exact Mass | 705.21 |
| IUPAC Name | 3-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-[[(2R,4S)-1-ethoxycarbonyl-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridin-4-yl]amino]pyrimidin-5-yl]propane-1-sulfonic acid |
| SMILES | CCOC(=O)N1c2ccc(OC)nc2[C@@H](Nc2ncc(CCCS(=O)(=O)O)c(Cc3cc(C(F)(F)F)cc(C(F)(F)F)c3)n2)C[C@H]1CC |
| InChI | InChI=1S/C30H33F6N5O6S/c1-4-21-15-23(26-24(8-9-25(40-26)46-3)41(21)28(42)47-5-2)39-27-37-16-18(7-6-10-48(43,44)45)22(38-27)13-17-11-19(29(31,32)33)14-20(12-17)30(34,35)36/h8-9,11-12,14,16,21,23H,4-7,10,13,15H2,1-3H3,(H,37,38,39)(H,43,44,45)/t21-,23+/m1/s1 |
| InChIKey | GWTUPDZDKMWOMA-GGAORHGYSA-N |
| XLogP | 6.63 |
| TPSA | 143.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.68 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|