C29H29F6N5O5 — CID 87547051
2-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-[[(2R,4S)-1-ethoxycarbonyl-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridin-4-yl]amino]pyrimidin-5-yl]acetic acid (PubChem CID 87547051) has the molecular formula C29H29F6N5O5 and a molecular weight of 641.57 g/mol. Its IUPAC name is 2-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-[[(2R,4S)-1-ethoxycarbonyl-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridin-4-yl]amino]pyrimidin-5-yl]acetic acid.
| Compound Name | 2-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-[[(2R,4S)-1-ethoxycarbonyl-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridin-4-yl]amino]pyrimidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 87547051 |
| Molecular Formula | C29H29F6N5O5 |
| Molecular Weight | 641.57 g/mol |
| Exact Mass | 641.21 |
| IUPAC Name | 2-[4-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-[[(2R,4S)-1-ethoxycarbonyl-2-ethyl-6-methoxy-3,4-dihydro-2H-1,5-naphthyridin-4-yl]amino]pyrimidin-5-yl]acetic acid |
| SMILES | CCOC(=O)N1c2ccc(OC)nc2[C@@H](Nc2ncc(CC(=O)O)c(Cc3cc(C(F)(F)F)cc(C(F)(F)F)c3)n2)C[C@H]1CC |
| InChI | InChI=1S/C29H29F6N5O5/c1-4-19-13-21(25-22(6-7-23(39-25)44-3)40(19)27(43)45-5-2)38-26-36-14-16(11-24(41)42)20(37-26)10-15-8-17(28(30,31)32)12-18(9-15)29(33,34)35/h6-9,12,14,19,21H,4-5,10-11,13H2,1-3H3,(H,41,42)(H,36,37,38)/t19-,21+/m1/s1 |
| InChIKey | IMEGYDQQBVYLIL-CTNGQTDRSA-N |
| XLogP | 6.43 |
| TPSA | 126.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.57 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |